C15H22F3NO — CID 97098122
[(1S)-cyclohex-3-en-1-yl]-[(2S)-2-propyl-2-(trifluoromethyl)pyrrolidin-1-yl]methanone (PubChem CID 97098122) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is [(1S)-cyclohex-3-en-1-yl]-[(2S)-2-propyl-2-(trifluoromethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [(1S)-cyclohex-3-en-1-yl]-[(2S)-2-propyl-2-(trifluoromethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 97098122 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(1S)-cyclohex-3-en-1-yl]-[(2S)-2-propyl-2-(trifluoromethyl)pyrrolidin-1-yl]methanone |
| SMILES | CCC[C@@]1(C(F)(F)F)CCCN1C(=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C15H22F3NO/c1-2-9-14(15(16,17)18)10-6-11-19(14)13(20)12-7-4-3-5-8-12/h3-4,12H,2,5-11H2,1H3/t12-,14+/m1/s1 |
| InChIKey | VJKFHVZYPZLBOS-OCCSQVGLSA-N |
| XLogP | 4.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|