C17H32N2O3S — CID 97101498
N-[(2S,3S)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine (PubChem CID 97101498) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is N-[(2S,3S)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine.
| Compound Name | N-[(2S,3S)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine |
|---|---|
| PubChem CID | 97101498 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[(2S,3S)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine |
| SMILES | C=CC[C@H](C)[C@H](C)NC1CCN(S(=O)(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C17H32N2O3S/c1-4-5-14(2)15(3)18-16-6-10-19(11-7-16)23(20,21)17-8-12-22-13-9-17/h4,14-18H,1,5-13H2,2-3H3/t14-,15-/m0/s1 |
| InChIKey | BHNWZEXUGSDARL-GJZGRUSLSA-N |
| XLogP | 2.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|