C14H23N3O3S2 — CID 146145032
1-(oxan-4-ylsulfonyl)-N-(1,2-thiazol-4-ylmethyl)piperidin-4-amine (PubChem CID 146145032) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-(oxan-4-ylsulfonyl)-N-(1,2-thiazol-4-ylmethyl)piperidin-4-amine.
| Compound Name | 1-(oxan-4-ylsulfonyl)-N-(1,2-thiazol-4-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 146145032 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-(oxan-4-ylsulfonyl)-N-(1,2-thiazol-4-ylmethyl)piperidin-4-amine |
| SMILES | O=S(=O)(C1CCOCC1)N1CCC(NCc2cnsc2)CC1 |
| InChI | InChI=1S/C14H23N3O3S2/c18-22(19,14-3-7-20-8-4-14)17-5-1-13(2-6-17)15-9-12-10-16-21-11-12/h10-11,13-15H,1-9H2 |
| InChIKey | PJNYPUHSOATLAU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |