C16H23N5O2S — CID 154736430
1-cyclopropylsulfonyl-N-[(1-methylbenzotriazol-5-yl)methyl]piperidin-4-amine (PubChem CID 154736430) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-N-[(1-methylbenzotriazol-5-yl)methyl]piperidin-4-amine.
| Compound Name | 1-cyclopropylsulfonyl-N-[(1-methylbenzotriazol-5-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 154736430 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-cyclopropylsulfonyl-N-[(1-methylbenzotriazol-5-yl)methyl]piperidin-4-amine |
| SMILES | Cn1nnc2cc(CNC3CCN(S(=O)(=O)C4CC4)CC3)ccc21 |
| InChI | InChI=1S/C16H23N5O2S/c1-20-16-5-2-12(10-15(16)18-19-20)11-17-13-6-8-21(9-7-13)24(22,23)14-3-4-14/h2,5,10,13-14,17H,3-4,6-9,11H2,1H3 |
| InChIKey | XOUBFFDQHMCGEH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |