About N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine
N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine (PubChem CID 97101499) has the molecular formula C17H32N2O3S
and a molecular weight of 344.52 g/mol. Its IUPAC name is N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine |
| PubChem CID | 97101499 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine |
| SMILES | C=CC[C@@H](C)[C@H](C)NC1CCN(S(=O)(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C17H32N2O3S/c1-4-5-14(2)15(3)18-16-6-10-19(11-7-16)23(20,21)17-8-12-22-13-9-17/h4,14-18H,1,5-13H2,2-3H3/t14-,15+/m1/s1 |
| InChIKey | BHNWZEXUGSDARL-CABCVRRESA-N |
| XLogP | 2.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine?
The IUPAC name of N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine (CID 97101499) is N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine.
What is the SMILES notation for N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine?
The canonical SMILES for N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine is C=CC[C@@H](C)[C@H](C)NC1CCN(S(=O)(=O)C2CCOCC2)CC1.
What is the InChIKey of N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine?
The InChIKey is BHNWZEXUGSDARL-CABCVRRESA-N. The full InChI is InChI=1S/C17H32N2O3S/c1-4-5-14(2)15(3)18-16-6-10-19(11-7-16)23(20,21)17-8-12-22-13-9-17/h4,14-18H,1,5-13H2,2-3H3/t14-,15+/m1/s1.
What are the key properties of N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine?
N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine has a molecular weight of 344.52 g/mol, XLogP of 2.15, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3R)-3-methylhex-5-en-2-yl]-1-(oxan-4-ylsulfonyl)piperidin-4-amine is sourced from PubChem (CID 97101499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).