C11H10BrNO5S — CID 97103859
methyl 3-bromo-4-[(5R)-1,1,3-trioxo-1,2-thiazolidin-5-yl]benzoate (PubChem CID 97103859) has the molecular formula C11H10BrNO5S and a molecular weight of 348.17 g/mol. Its IUPAC name is methyl 3-bromo-4-[(5R)-1,1,3-trioxo-1,2-thiazolidin-5-yl]benzoate.
| Compound Name | methyl 3-bromo-4-[(5R)-1,1,3-trioxo-1,2-thiazolidin-5-yl]benzoate |
|---|---|
| PubChem CID | 97103859 |
| Molecular Formula | C11H10BrNO5S |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | methyl 3-bromo-4-[(5R)-1,1,3-trioxo-1,2-thiazolidin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2CC(=O)NS2(=O)=O)c(Br)c1 |
| InChI | InChI=1S/C11H10BrNO5S/c1-18-11(15)6-2-3-7(8(12)4-6)9-5-10(14)13-19(9,16)17/h2-4,9H,5H2,1H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | SNXNWXVHQBYUIX-SECBINFHSA-N |
| XLogP | 1.13 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |