C11H9BrNO5S- — CID 87969346
methyl 3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)benzoate (PubChem CID 87969346) has the molecular formula C11H9BrNO5S- and a molecular weight of 347.17 g/mol. Its IUPAC name is methyl 3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)benzoate.
| Compound Name | methyl 3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)benzoate |
|---|---|
| PubChem CID | 87969346 |
| Molecular Formula | C11H9BrNO5S- |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | methyl 3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2CC(=O)[N+]([O-])([O-])S2)c(Br)c1 |
| InChI | InChI=1S/C11H9BrNO5S/c1-18-11(15)6-2-3-7(8(12)4-6)9-5-10(14)13(16,17)19-9/h2-4,9H,5H2,1H3/q-1 |
| InChIKey | YHPGOEKHCGLGMC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|