C12H19F3N2OS — CID 97104581
(3R)-3-(thian-4-ylamino)-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 97104581) has the molecular formula C12H19F3N2OS and a molecular weight of 296.36 g/mol. Its IUPAC name is (3R)-3-(thian-4-ylamino)-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | (3R)-3-(thian-4-ylamino)-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 97104581 |
| Molecular Formula | C12H19F3N2OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (3R)-3-(thian-4-ylamino)-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | O=C1[C@H](NC2CCSCC2)CCCN1CC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2OS/c13-12(14,15)8-17-5-1-2-10(11(17)18)16-9-3-6-19-7-4-9/h9-10,16H,1-8H2/t10-/m1/s1 |
| InChIKey | VKZYBFPMQSOPDC-SNVBAGLBSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |