C18H22N4O4S — CID 97104627
(3R)-1-(1-methyl-6-oxopyridazin-3-yl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide (PubChem CID 97104627) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is (3R)-1-(1-methyl-6-oxopyridazin-3-yl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(1-methyl-6-oxopyridazin-3-yl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97104627 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (3R)-1-(1-methyl-6-oxopyridazin-3-yl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide |
| SMILES | Cn1nc(N2CCC[C@@H](C(=O)Nc3ccc(S(C)(=O)=O)cc3)C2)ccc1=O |
| InChI | InChI=1S/C18H22N4O4S/c1-21-17(23)10-9-16(20-21)22-11-3-4-13(12-22)18(24)19-14-5-7-15(8-6-14)27(2,25)26/h5-10,13H,3-4,11-12H2,1-2H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | DNHSJBAZRPVRIK-CYBMUJFWSA-N |
| XLogP | 1.04 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |