C18H21ClN2O5 — CID 97106459
N'-(3-chloro-4-methoxyphenyl)-N-[(3S)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]oxamide (PubChem CID 97106459) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is N'-(3-chloro-4-methoxyphenyl)-N-[(3S)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]oxamide.
| Compound Name | N'-(3-chloro-4-methoxyphenyl)-N-[(3S)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 97106459 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N'-(3-chloro-4-methoxyphenyl)-N-[(3S)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCC[C@H](O)c2cc(C)oc2C)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O5/c1-10-8-13(11(2)26-10)15(22)6-7-20-17(23)18(24)21-12-4-5-16(25-3)14(19)9-12/h4-5,8-9,15,22H,6-7H2,1-3H3,(H,20,23)(H,21,24)/t15-/m0/s1 |
| InChIKey | OQUQTFSQEPFIMZ-HNNXBMFYSA-N |
| XLogP | 2.74 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|