C16H18ClN3O4 — CID 95982595
N'-(3-chloro-4-methoxyphenyl)-N-[(2R)-2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]oxamide (PubChem CID 95982595) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is N'-(3-chloro-4-methoxyphenyl)-N-[(2R)-2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]oxamide.
| Compound Name | N'-(3-chloro-4-methoxyphenyl)-N-[(2R)-2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 95982595 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N'-(3-chloro-4-methoxyphenyl)-N-[(2R)-2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NC[C@@H](O)c2cccn2C)cc1Cl |
| InChI | InChI=1S/C16H18ClN3O4/c1-20-7-3-4-12(20)13(21)9-18-15(22)16(23)19-10-5-6-14(24-2)11(17)8-10/h3-8,13,21H,9H2,1-2H3,(H,18,22)(H,19,23)/t13-/m1/s1 |
| InChIKey | JJBYCDNMDUWJOC-CYBMUJFWSA-N |
| XLogP | 1.48 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|