C20H20ClN3O — CID 97109749
8-chloro-2-[[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]methyl]-1H-quinolin-4-one (PubChem CID 97109749) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 8-chloro-2-[[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]methyl]-1H-quinolin-4-one.
| Compound Name | 8-chloro-2-[[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 97109749 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 8-chloro-2-[[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]methyl]-1H-quinolin-4-one |
| SMILES | CN(Cc1cc(=O)c2cccc(Cl)c2[nH]1)[C@H](c1ccccn1)C1CC1 |
| InChI | InChI=1S/C20H20ClN3O/c1-24(20(13-8-9-13)17-7-2-3-10-22-17)12-14-11-18(25)15-5-4-6-16(21)19(15)23-14/h2-7,10-11,13,20H,8-9,12H2,1H3,(H,23,25)/t20-/m0/s1 |
| InChIKey | LXVMZOMXCUBTBF-FQEVSTJZSA-N |
| XLogP | 4.16 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |