C18H21N3OS — CID 97113138
N,3,5,7-tetramethyl-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 97113138) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is N,3,5,7-tetramethyl-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | N,3,5,7-tetramethyl-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 97113138 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N,3,5,7-tetramethyl-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)N(C)[C@@H](C)c3cncs3)c(C)c2c1 |
| InChI | InChI=1S/C18H21N3OS/c1-10-6-11(2)16-14(7-10)12(3)17(20-16)18(22)21(5)13(4)15-8-19-9-23-15/h6-9,13,20H,1-5H3/t13-/m0/s1 |
| InChIKey | LTQZCXSZROWHBA-ZDUSSCGKSA-N |
| XLogP | 4.38 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|