About (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one
(3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one (PubChem CID 97113863) has the molecular formula C20H27N5O2
and a molecular weight of 369.47 g/mol. Its IUPAC name is (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one.
Molecular Properties
| Compound Name | (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one |
| PubChem CID | 97113863 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one |
| SMILES | CC(=O)c1c(C)nn([C@H](C)CC(=O)N2CCN(c3cccnc3)CC2)c1C |
| InChI | InChI=1S/C20H27N5O2/c1-14(25-16(3)20(17(4)26)15(2)22-25)12-19(27)24-10-8-23(9-11-24)18-6-5-7-21-13-18/h5-7,13-14H,8-12H2,1-4H3/t14-/m1/s1 |
| InChIKey | MPZULXKEAIJDSV-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one?
The IUPAC name of (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one (CID 97113863) is (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one.
What is the SMILES notation for (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one?
The canonical SMILES for (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one is CC(=O)c1c(C)nn([C@H](C)CC(=O)N2CCN(c3cccnc3)CC2)c1C.
What is the InChIKey of (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one?
The InChIKey is MPZULXKEAIJDSV-CQSZACIVSA-N. The full InChI is InChI=1S/C20H27N5O2/c1-14(25-16(3)20(17(4)26)15(2)22-25)12-19(27)24-10-8-23(9-11-24)18-6-5-7-21-13-18/h5-7,13-14H,8-12H2,1-4H3/t14-/m1/s1.
What are the key properties of (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one?
(3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one has a molecular weight of 369.47 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(4-pyridin-3-ylpiperazin-1-yl)butan-1-one is sourced from PubChem (CID 97113863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).