C23H26N4O — CID 97121325
2-(2-phenylimidazol-1-yl)-1-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethanone (PubChem CID 97121325) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-(2-phenylimidazol-1-yl)-1-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(2-phenylimidazol-1-yl)-1-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97121325 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-(2-phenylimidazol-1-yl)-1-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(Cn1ccnc1-c1ccccc1)N1CCCC[C@@H]1CCc1ccccn1 |
| InChI | InChI=1S/C23H26N4O/c28-22(18-26-17-15-25-23(26)19-8-2-1-3-9-19)27-16-7-5-11-21(27)13-12-20-10-4-6-14-24-20/h1-4,6,8-10,14-15,17,21H,5,7,11-13,16,18H2/t21-/m1/s1 |
| InChIKey | KXPUZRUSEHEINR-OAQYLSRUSA-N |
| XLogP | 3.96 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |