C17H22N4O3 — CID 99929974
1-[2-oxo-2-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 99929974) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[2-oxo-2-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-[2-oxo-2-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99929974 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[2-oxo-2-[(2R)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(CC(=O)N2CCCC[C@@H]2CCc2ccccn2)C(=O)N1 |
| InChI | InChI=1S/C17H22N4O3/c22-15-11-20(17(24)19-15)12-16(23)21-10-4-2-6-14(21)8-7-13-5-1-3-9-18-13/h1,3,5,9,14H,2,4,6-8,10-12H2,(H,19,22,24)/t14-/m1/s1 |
| InChIKey | KLJBFIPKDFHPFQ-CQSZACIVSA-N |
| XLogP | 0.95 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|