C16H25NO2 — CID 97122464
[(3S)-1-(furan-3-ylmethyl)-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol (PubChem CID 97122464) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is [(3S)-1-(furan-3-ylmethyl)-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(furan-3-ylmethyl)-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97122464 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | [(3S)-1-(furan-3-ylmethyl)-3-(3-methylbut-2-enyl)piperidin-3-yl]methanol |
| SMILES | CC(C)=CC[C@@]1(CO)CCCN(Cc2ccoc2)C1 |
| InChI | InChI=1S/C16H25NO2/c1-14(2)4-7-16(13-18)6-3-8-17(12-16)10-15-5-9-19-11-15/h4-5,9,11,18H,3,6-8,10,12-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | PEDYRKAFWPJTFY-INIZCTEOSA-N |
| XLogP | 3.21 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|