C14H16ClNO3S — CID 97126715
(3R)-1-(5-chlorothiophene-2-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97126715) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is (3R)-1-(5-chlorothiophene-2-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(5-chlorothiophene-2-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97126715 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (3R)-1-(5-chlorothiophene-2-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@]1(C(=O)O)CCCN(C(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C14H16ClNO3S/c1-2-6-14(13(18)19)7-3-8-16(9-14)12(17)10-4-5-11(15)20-10/h2,4-5H,1,3,6-9H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | QCWHFQUGFZXKBP-AWEZNQCLSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|