C18H23NO3S — CID 97152804
(3S)-3-prop-2-enyl-1-(4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)piperidine-3-carboxylic acid (PubChem CID 97152804) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is (3S)-3-prop-2-enyl-1-(4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-3-prop-2-enyl-1-(4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97152804 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (3S)-3-prop-2-enyl-1-(4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)piperidine-3-carboxylic acid |
| SMILES | C=CC[C@@]1(C(=O)O)CCCN(C(=O)c2scc3c2CCCC3)C1 |
| InChI | InChI=1S/C18H23NO3S/c1-2-8-18(17(21)22)9-5-10-19(12-18)16(20)15-14-7-4-3-6-13(14)11-23-15/h2,11H,1,3-10,12H2,(H,21,22)/t18-/m1/s1 |
| InChIKey | SSDSTTZWDKWPEU-GOSISDBHSA-N |
| XLogP | 3.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|