C12H17N3O2S — CID 97145078
(3R)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97145078) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is (3R)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97145078 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (3R)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@]1(C(=O)O)CCCN(c2nnc(C)s2)C1 |
| InChI | InChI=1S/C12H17N3O2S/c1-3-5-12(10(16)17)6-4-7-15(8-12)11-14-13-9(2)18-11/h3H,1,4-8H2,2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | BIOUEPVFWXAALY-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|