C17H24N4O3 — CID 97131412
(3R)-1-(6-morpholin-4-ylpyrimidin-4-yl)-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97131412) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3R)-1-(6-morpholin-4-ylpyrimidin-4-yl)-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(6-morpholin-4-ylpyrimidin-4-yl)-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97131412 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (3R)-1-(6-morpholin-4-ylpyrimidin-4-yl)-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@]1(C(=O)O)CCCN(c2cc(N3CCOCC3)ncn2)C1 |
| InChI | InChI=1S/C17H24N4O3/c1-2-4-17(16(22)23)5-3-6-21(12-17)15-11-14(18-13-19-15)20-7-9-24-10-8-20/h2,11,13H,1,3-10,12H2,(H,22,23)/t17-/m0/s1 |
| InChIKey | KYCVBRVUMZXCLS-KRWDZBQOSA-N |
| XLogP | 1.56 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|