C14H23NO2S2 — CID 97121223
(3S)-1-(1,4-dithiepan-6-yl)-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97121223) has the molecular formula C14H23NO2S2 and a molecular weight of 301.48 g/mol. Its IUPAC name is (3S)-1-(1,4-dithiepan-6-yl)-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(1,4-dithiepan-6-yl)-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97121223 |
| Molecular Formula | C14H23NO2S2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (3S)-1-(1,4-dithiepan-6-yl)-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@@]1(C(=O)O)CCCN(C2CSCCSC2)C1 |
| InChI | InChI=1S/C14H23NO2S2/c1-2-4-14(13(16)17)5-3-6-15(11-14)12-9-18-7-8-19-10-12/h2,12H,1,3-11H2,(H,16,17)/t14-/m1/s1 |
| InChIKey | RYZGTZVVJJEQMX-CQSZACIVSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|