C20H23N3O5 — CID 97137758
(3R)-1-[2-(2,4-dioxo-1,3-diazinan-1-yl)benzoyl]-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97137758) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (3R)-1-[2-(2,4-dioxo-1,3-diazinan-1-yl)benzoyl]-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(2,4-dioxo-1,3-diazinan-1-yl)benzoyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97137758 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (3R)-1-[2-(2,4-dioxo-1,3-diazinan-1-yl)benzoyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@]1(C(=O)O)CCCN(C(=O)c2ccccc2N2CCC(=O)NC2=O)C1 |
| InChI | InChI=1S/C20H23N3O5/c1-2-9-20(18(26)27)10-5-11-22(13-20)17(25)14-6-3-4-7-15(14)23-12-8-16(24)21-19(23)28/h2-4,6-7H,1,5,8-13H2,(H,26,27)(H,21,24,28)/t20-/m0/s1 |
| InChIKey | JZQUFAZMTSARHY-FQEVSTJZSA-N |
| XLogP | 2.02 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|