C20H31N3O2S — CID 97139352
(5S)-5-methyl-5-(4-methylpent-3-enyl)-1-[(2-morpholin-4-yl-1,3-thiazol-4-yl)methyl]piperidin-2-one (PubChem CID 97139352) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-[(2-morpholin-4-yl-1,3-thiazol-4-yl)methyl]piperidin-2-one.
| Compound Name | (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-[(2-morpholin-4-yl-1,3-thiazol-4-yl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 97139352 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-[(2-morpholin-4-yl-1,3-thiazol-4-yl)methyl]piperidin-2-one |
| SMILES | CC(C)=CCC[C@@]1(C)CCC(=O)N(Cc2csc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C20H31N3O2S/c1-16(2)5-4-7-20(3)8-6-18(24)23(15-20)13-17-14-26-19(21-17)22-9-11-25-12-10-22/h5,14H,4,6-13,15H2,1-3H3/t20-/m0/s1 |
| InChIKey | JBOMVQJAGFUQJY-FQEVSTJZSA-N |
| XLogP | 3.85 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|