C19H26N4O — CID 97151555
(5S)-5-methyl-5-(4-methylpent-3-enyl)-1-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)piperidin-2-one (PubChem CID 97151555) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)piperidin-2-one.
| Compound Name | (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)piperidin-2-one |
|---|---|
| PubChem CID | 97151555 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)piperidin-2-one |
| SMILES | CC(C)=CCC[C@@]1(C)CCC(=O)N(Cc2cnn3cccnc23)C1 |
| InChI | InChI=1S/C19H26N4O/c1-15(2)6-4-8-19(3)9-7-17(24)22(14-19)13-16-12-21-23-11-5-10-20-18(16)23/h5-6,10-12H,4,7-9,13-14H2,1-3H3/t19-/m0/s1 |
| InChIKey | PSJAEJUXKBCHJS-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|