C15H16FN5O2S — CID 97142730
(4S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 97142730) has the molecular formula C15H16FN5O2S and a molecular weight of 349.39 g/mol. Its IUPAC name is (4S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | (4S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 97142730 |
| Molecular Formula | C15H16FN5O2S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (4S)-N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | Nc1nnc(CCCNC(=O)[C@H]2CC(=O)Nc3ccc(F)cc32)s1 |
| InChI | InChI=1S/C15H16FN5O2S/c16-8-3-4-11-9(6-8)10(7-12(22)19-11)14(23)18-5-1-2-13-20-21-15(17)24-13/h3-4,6,10H,1-2,5,7H2,(H2,17,21)(H,18,23)(H,19,22)/t10-/m0/s1 |
| InChIKey | JQFDOOBGCZCVJR-JTQLQIEISA-N |
| XLogP | 1.43 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|