C19H25FN2O2S — CID 70781799
N-(3-cyclohexylsulfanylpropyl)-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 70781799) has the molecular formula C19H25FN2O2S and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70781799 |
| Molecular Formula | C19H25FN2O2S |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | O=C1CC(C(=O)NCCCSC2CCCCC2)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C19H25FN2O2S/c20-13-7-8-17-15(11-13)16(12-18(23)22-17)19(24)21-9-4-10-25-14-5-2-1-3-6-14/h7-8,11,14,16H,1-6,9-10,12H2,(H,21,24)(H,22,23) |
| InChIKey | WHLLIMFLXNWZLB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|