C14H14N4OS2 — CID 97145683
N-[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 97145683) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is N-[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 97145683 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | Cc1nc2c(s1)CCC[C@H]2NC(=O)c1cn2ccsc2n1 |
| InChI | InChI=1S/C14H14N4OS2/c1-8-15-12-9(3-2-4-11(12)21-8)16-13(19)10-7-18-5-6-20-14(18)17-10/h5-7,9H,2-4H2,1H3,(H,16,19)/t9-/m1/s1 |
| InChIKey | PRUHXJPAJHRQEK-SECBINFHSA-N |
| XLogP | 2.97 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |