C13H14N4OS2 — CID 70770649
N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 70770649) has the molecular formula C13H14N4OS2 and a molecular weight of 306.42 g/mol. Its IUPAC name is N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 70770649 |
| Molecular Formula | C13H14N4OS2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)c2cn3ccsc3n2)n1 |
| InChI | InChI=1S/C13H14N4OS2/c1-9-8-20-11(15-9)3-2-4-14-12(18)10-7-17-5-6-19-13(17)16-10/h5-8H,2-4H2,1H3,(H,14,18) |
| InChIKey | AAVCVOWTDOZBTD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|