C15H19N3O3S2 — CID 97146505
4-(propylsulfamoyl)-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 97146505) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-(propylsulfamoyl)-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 4-(propylsulfamoyl)-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 97146505 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-(propylsulfamoyl)-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | CCCNS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2nccs2)cc1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-3-8-17-23(20,21)13-6-4-12(5-7-13)14(19)18-11(2)15-16-9-10-22-15/h4-7,9-11,17H,3,8H2,1-2H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | CGEHSMNUWKNKDC-LLVKDONJSA-N |
| XLogP | 2.32 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |