C22H30FN3O — CID 97147209
(5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-(piperidin-1-ylmethyl)piperidin-1-yl]methanone (PubChem CID 97147209) has the molecular formula C22H30FN3O and a molecular weight of 371.50 g/mol. Its IUPAC name is (5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-(piperidin-1-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-(piperidin-1-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97147209 |
| Molecular Formula | C22H30FN3O |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | (5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-(piperidin-1-ylmethyl)piperidin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCC[C@@H](CN3CCCCC3)C2)n(C)c2ccc(F)cc12 |
| InChI | InChI=1S/C22H30FN3O/c1-16-19-13-18(23)8-9-20(19)24(2)21(16)22(27)26-12-6-7-17(15-26)14-25-10-4-3-5-11-25/h8-9,13,17H,3-7,10-12,14-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | ASXCUNAXIZIILA-KRWDZBQOSA-N |
| XLogP | 3.96 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|