C21H28FN3O — CID 70719048
(4-cyclopentyl-1,4-diazepan-1-yl)-(5-fluoro-1,3-dimethylindol-2-yl)methanone (PubChem CID 70719048) has the molecular formula C21H28FN3O and a molecular weight of 357.47 g/mol. Its IUPAC name is (4-cyclopentyl-1,4-diazepan-1-yl)-(5-fluoro-1,3-dimethylindol-2-yl)methanone.
| Compound Name | (4-cyclopentyl-1,4-diazepan-1-yl)-(5-fluoro-1,3-dimethylindol-2-yl)methanone |
|---|---|
| PubChem CID | 70719048 |
| Molecular Formula | C21H28FN3O |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | (4-cyclopentyl-1,4-diazepan-1-yl)-(5-fluoro-1,3-dimethylindol-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCCN(C3CCCC3)CC2)n(C)c2ccc(F)cc12 |
| InChI | InChI=1S/C21H28FN3O/c1-15-18-14-16(22)8-9-19(18)23(2)20(15)21(26)25-11-5-10-24(12-13-25)17-6-3-4-7-17/h8-9,14,17H,3-7,10-13H2,1-2H3 |
| InChIKey | OQKYSAGQUWQZSP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|