C21H21FN2O2 — CID 126450498
(5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-phenoxypyrrolidin-1-yl]methanone (PubChem CID 126450498) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is (5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-phenoxypyrrolidin-1-yl]methanone.
| Compound Name | (5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-phenoxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 126450498 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (5-fluoro-1,3-dimethylindol-2-yl)-[(3S)-3-phenoxypyrrolidin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CC[C@H](Oc3ccccc3)C2)n(C)c2ccc(F)cc12 |
| InChI | InChI=1S/C21H21FN2O2/c1-14-18-12-15(22)8-9-19(18)23(2)20(14)21(25)24-11-10-17(13-24)26-16-6-4-3-5-7-16/h3-9,12,17H,10-11,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | AXJXZZXGJCLNRQ-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|