C19H20F3NO — CID 97147227
[3-[[(3S)-1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methyl]phenyl]methanol (PubChem CID 97147227) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is [3-[[(3S)-1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methyl]phenyl]methanol.
| Compound Name | [3-[[(3S)-1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 97147227 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [3-[[(3S)-1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methyl]phenyl]methanol |
| SMILES | OCc1cccc(C[C@H]2CCN(Cc3cc(F)cc(F)c3F)C2)c1 |
| InChI | InChI=1S/C19H20F3NO/c20-17-8-16(19(22)18(21)9-17)11-23-5-4-14(10-23)6-13-2-1-3-15(7-13)12-24/h1-3,7-9,14,24H,4-6,10-12H2/t14-/m1/s1 |
| InChIKey | BDGATNSYLQUAEB-CQSZACIVSA-N |
| XLogP | 3.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|