C15H25N3O3 — CID 97148320
[(3S)-1-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-(3-methoxypropyl)piperidin-3-yl]methanol (PubChem CID 97148320) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is [(3S)-1-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-(3-methoxypropyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-(3-methoxypropyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97148320 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | [(3S)-1-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-(3-methoxypropyl)piperidin-3-yl]methanol |
| SMILES | COCCC[C@@]1(CO)CCCN(c2noc(C3CC3)n2)C1 |
| InChI | InChI=1S/C15H25N3O3/c1-20-9-3-7-15(11-19)6-2-8-18(10-15)14-16-13(21-17-14)12-4-5-12/h12,19H,2-11H2,1H3/t15-/m0/s1 |
| InChIKey | QJCJWJBUWWAOHO-HNNXBMFYSA-N |
| XLogP | 1.95 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|