C19H26N2O — CID 97149001
2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)acetamide (PubChem CID 97149001) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)acetamide.
| Compound Name | 2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)acetamide |
|---|---|
| PubChem CID | 97149001 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1CCc2ccccc21)NCC12CCCN1CCC2 |
| InChI | InChI=1S/C19H26N2O/c22-18(13-16-8-7-15-5-1-2-6-17(15)16)20-14-19-9-3-11-21(19)12-4-10-19/h1-2,5-6,16H,3-4,7-14H2,(H,20,22)/t16-/m0/s1 |
| InChIKey | UGCDIZRUUYRUPX-INIZCTEOSA-N |
| XLogP | 2.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |