C14H15F4N3O3 — CID 97149101
(3R)-N-(3-fluoro-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 97149101) has the molecular formula C14H15F4N3O3 and a molecular weight of 349.28 g/mol. Its IUPAC name is (3R)-N-(3-fluoro-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-fluoro-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97149101 |
| Molecular Formula | C14H15F4N3O3 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (3R)-N-(3-fluoro-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(F)c1)[C@@H]1CCCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H15F4N3O3/c15-11-6-10(3-4-12(11)21(23)24)19-13(22)9-2-1-5-20(7-9)8-14(16,17)18/h3-4,6,9H,1-2,5,7-8H2,(H,19,22)/t9-/m1/s1 |
| InChIKey | QLFGYOMUBJSGJP-SECBINFHSA-N |
| XLogP | 2.95 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|