C16H19N3O4 — CID 97150039
ethyl 1-[(3R)-1-(furan-2-carbonyl)piperidin-3-yl]pyrazole-4-carboxylate (PubChem CID 97150039) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethyl 1-[(3R)-1-(furan-2-carbonyl)piperidin-3-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[(3R)-1-(furan-2-carbonyl)piperidin-3-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 97150039 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl 1-[(3R)-1-(furan-2-carbonyl)piperidin-3-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn([C@@H]2CCCN(C(=O)c3ccco3)C2)c1 |
| InChI | InChI=1S/C16H19N3O4/c1-2-22-16(21)12-9-17-19(10-12)13-5-3-7-18(11-13)15(20)14-6-4-8-23-14/h4,6,8-10,13H,2-3,5,7,11H2,1H3/t13-/m1/s1 |
| InChIKey | AOMRPCTXQZZFKA-CYBMUJFWSA-N |
| XLogP | 2.13 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |