C20H30N2O2S — CID 97150140
(5R)-2-[2-(1-adamantylsulfanyl)acetyl]-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97150140) has the molecular formula C20H30N2O2S and a molecular weight of 362.54 g/mol. Its IUPAC name is (5R)-2-[2-(1-adamantylsulfanyl)acetyl]-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5R)-2-[2-(1-adamantylsulfanyl)acetyl]-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97150140 |
| Molecular Formula | C20H30N2O2S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (5R)-2-[2-(1-adamantylsulfanyl)acetyl]-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C(CSC12CC3CC(CC(C3)C1)C2)N1CC[C@]2(CCCNC2=O)C1 |
| InChI | InChI=1S/C20H30N2O2S/c23-17(22-5-3-19(13-22)2-1-4-21-18(19)24)12-25-20-9-14-6-15(10-20)8-16(7-14)11-20/h14-16H,1-13H2,(H,21,24)/t14?,15?,16?,19-,20?/m1/s1 |
| InChIKey | XSKLIWAJQVIEOD-JCFBCRGFSA-N |
| XLogP | 2.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |