C19H25N3O3 — CID 97155422
5-cyclohexyl-N-[(2R)-2-hydroxy-3-phenoxypropyl]-1H-pyrazole-4-carboxamide (PubChem CID 97155422) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 5-cyclohexyl-N-[(2R)-2-hydroxy-3-phenoxypropyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-cyclohexyl-N-[(2R)-2-hydroxy-3-phenoxypropyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 97155422 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 5-cyclohexyl-N-[(2R)-2-hydroxy-3-phenoxypropyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC[C@@H](O)COc1ccccc1)c1cn[nH]c1C1CCCCC1 |
| InChI | InChI=1S/C19H25N3O3/c23-15(13-25-16-9-5-2-6-10-16)11-20-19(24)17-12-21-22-18(17)14-7-3-1-4-8-14/h2,5-6,9-10,12,14-15,23H,1,3-4,7-8,11,13H2,(H,20,24)(H,21,22)/t15-/m1/s1 |
| InChIKey | OYVIADNPMLCJJA-OAHLLOKOSA-N |
| XLogP | 2.63 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |