C20H27ClN4O — CID 97454957
N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide (PubChem CID 97454957) has the molecular formula C20H27ClN4O and a molecular weight of 374.92 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 97454957 |
| Molecular Formula | C20H27ClN4O |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide |
| SMILES | CN(C)[C@H](CNC(=O)c1cn[nH]c1C1CCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C20H27ClN4O/c1-25(2)18(15-10-6-7-11-17(15)21)13-22-20(26)16-12-23-24-19(16)14-8-4-3-5-9-14/h6-7,10-12,14,18H,3-5,8-9,13H2,1-2H3,(H,22,26)(H,23,24)/t18-/m1/s1 |
| InChIKey | SYETXSFZTIKMRD-GOSISDBHSA-N |
| XLogP | 4.14 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |