C17H24N2OS — CID 97159509
[4-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,4-diazepan-1-yl]-thiophen-2-ylmethanone (PubChem CID 97159509) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is [4-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,4-diazepan-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,4-diazepan-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 97159509 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [4-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,4-diazepan-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCCN(C[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C17H24N2OS/c20-17(16-8-4-13-21-16)19-10-5-9-18(11-12-19)14-15-6-2-1-3-7-15/h1-2,4,8,13,15H,3,5-7,9-12,14H2/t15-/m1/s1 |
| InChIKey | QTELFGLGIGUOAW-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|