About difluoro(phenyl)arsane
difluoro(phenyl)arsane (PubChem CID 9716) has the molecular formula C6H5AsF2
and a molecular weight of 190.02 g/mol. Its IUPAC name is difluoro(phenyl)arsane.
Molecular Properties
| Compound Name | difluoro(phenyl)arsane |
| PubChem CID | 9716 |
| Molecular Formula | C6H5AsF2 |
| Molecular Weight | 190.02 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | difluoro(phenyl)arsane |
| SMILES | F[As](F)c1ccccc1 |
| InChI | InChI=1S/C6H5AsF2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| InChIKey | VFMMEYOORMCMRV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.02 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze difluoro(phenyl)arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoro(phenyl)arsane?
The IUPAC name of difluoro(phenyl)arsane (CID 9716) is difluoro(phenyl)arsane.
What is the SMILES notation for difluoro(phenyl)arsane?
The canonical SMILES for difluoro(phenyl)arsane is F[As](F)c1ccccc1.
What is the InChIKey of difluoro(phenyl)arsane?
The InChIKey is VFMMEYOORMCMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5AsF2/c8-7(9)6-4-2-1-3-5-6/h1-5H.
What are the key properties of difluoro(phenyl)arsane?
difluoro(phenyl)arsane has a molecular weight of 190.02 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(phenyl)arsane is sourced from PubChem (CID 9716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).