C13H22N6 — CID 97160556
1,2-dimethyl-3-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]guanidine (PubChem CID 97160556) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 97160556 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1,2-dimethyl-3-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NC)NC[C@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C13H22N6/c1-14-12(15-2)18-9-11-5-3-8-19(10-11)13-16-6-4-7-17-13/h4,6-7,11H,3,5,8-10H2,1-2H3,(H2,14,15,18)/t11-/m1/s1 |
| InChIKey | RCQUGPJKORSMQF-LLVKDONJSA-N |
| XLogP | 0.49 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|