C18H29N5O — CID 99715561
N-[4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]cyclohexyl]acetamide (PubChem CID 99715561) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]cyclohexyl]acetamide.
| Compound Name | N-[4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 99715561 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | N-[4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(NC[C@H]2CCCN(c3ncccn3)C2)CC1 |
| InChI | InChI=1S/C18H29N5O/c1-14(24)22-17-7-5-16(6-8-17)21-12-15-4-2-11-23(13-15)18-19-9-3-10-20-18/h3,9-10,15-17,21H,2,4-8,11-13H2,1H3,(H,22,24)/t15-,16?,17?/m1/s1 |
| InChIKey | NUZUOSKTYAQTBE-KLAILNCOSA-N |
| XLogP | 1.73 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |