C17H28N8O — CID 134089920
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl)-3-[(1-pyrimidin-2-ylpiperidin-3-yl)methyl]urea (PubChem CID 134089920) has the molecular formula C17H28N8O and a molecular weight of 360.47 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl)-3-[(1-pyrimidin-2-ylpiperidin-3-yl)methyl]urea.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl)-3-[(1-pyrimidin-2-ylpiperidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 134089920 |
| Molecular Formula | C17H28N8O |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl)-3-[(1-pyrimidin-2-ylpiperidin-3-yl)methyl]urea |
| SMILES | O=C(NCC1CCCN(c2ncccn2)C1)NC1CCC2NNNC2C1 |
| InChI | InChI=1S/C17H28N8O/c26-17(21-13-4-5-14-15(9-13)23-24-22-14)20-10-12-3-1-8-25(11-12)16-18-6-2-7-19-16/h2,6-7,12-15,22-24H,1,3-5,8-11H2,(H2,20,21,26) |
| InChIKey | ROVCZXJUTQLYFS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |