C16H28N2O4 — CID 97160965
tert-butyl 4-[[(2R)-2-acetamidopropanoyl]amino]cyclohexane-1-carboxylate (PubChem CID 97160965) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl 4-[[(2R)-2-acetamidopropanoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2R)-2-acetamidopropanoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 97160965 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | tert-butyl 4-[[(2R)-2-acetamidopropanoyl]amino]cyclohexane-1-carboxylate |
| SMILES | CC(=O)N[C@H](C)C(=O)NC1CCC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28N2O4/c1-10(17-11(2)19)14(20)18-13-8-6-12(7-9-13)15(21)22-16(3,4)5/h10,12-13H,6-9H2,1-5H3,(H,17,19)(H,18,20)/t10-,12?,13?/m1/s1 |
| InChIKey | DEDPCBHGYSCWKW-QFWMXSHPSA-N |
| XLogP | 1.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |