C12H14N2O2S — CID 97166130
2-[(R)-[(3S)-piperidin-3-yl]sulfinyl]-1,3-benzoxazole (PubChem CID 97166130) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(R)-[(3S)-piperidin-3-yl]sulfinyl]-1,3-benzoxazole.
| Compound Name | 2-[(R)-[(3S)-piperidin-3-yl]sulfinyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 97166130 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[(R)-[(3S)-piperidin-3-yl]sulfinyl]-1,3-benzoxazole |
| SMILES | O=[S@@](c1nc2ccccc2o1)[C@H]1CCCNC1 |
| InChI | InChI=1S/C12H14N2O2S/c15-17(9-4-3-7-13-8-9)12-14-10-5-1-2-6-11(10)16-12/h1-2,5-6,9,13H,3-4,7-8H2/t9-,17+/m0/s1 |
| InChIKey | YALBSUWMVIBYKB-HUTHGQBESA-N |
| XLogP | 1.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |