C18H28N2O3S — CID 97167266
tert-butyl (3R)-3-[[methyl-(2-thiophen-3-ylacetyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 97167266) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[methyl-(2-thiophen-3-ylacetyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[methyl-(2-thiophen-3-ylacetyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97167266 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl (3R)-3-[[methyl-(2-thiophen-3-ylacetyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CN(C[C@H]1CCCN(C(=O)OC(C)(C)C)C1)C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C18H28N2O3S/c1-18(2,3)23-17(22)20-8-5-6-15(12-20)11-19(4)16(21)10-14-7-9-24-13-14/h7,9,13,15H,5-6,8,10-12H2,1-4H3/t15-/m1/s1 |
| InChIKey | BAVJVPCPDCEYRM-OAHLLOKOSA-N |
| XLogP | 3.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |