C23H35P — CID 97170474
ditert-butyl-[(1S)-2-(2,4-dimethylphenyl)-1-methylcyclohexa-2,4-dien-1-yl]phosphane (PubChem CID 97170474) has the molecular formula C23H35P and a molecular weight of 342.51 g/mol. Its IUPAC name is ditert-butyl-[(1S)-2-(2,4-dimethylphenyl)-1-methylcyclohexa-2,4-dien-1-yl]phosphane.
| Compound Name | ditert-butyl-[(1S)-2-(2,4-dimethylphenyl)-1-methylcyclohexa-2,4-dien-1-yl]phosphane |
|---|---|
| PubChem CID | 97170474 |
| Molecular Formula | C23H35P |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | ditert-butyl-[(1S)-2-(2,4-dimethylphenyl)-1-methylcyclohexa-2,4-dien-1-yl]phosphane |
| SMILES | Cc1ccc(C2=CC=CC[C@]2(C)P(C(C)(C)C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C23H35P/c1-17-13-14-19(18(2)16-17)20-12-10-11-15-23(20,9)24(21(3,4)5)22(6,7)8/h10-14,16H,15H2,1-9H3/t23-/m0/s1 |
| InChIKey | UUHLMECQDMEEPM-QHCPKHFHSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|